C13H20ClN3O3S — CID 114443374
methyl 2-[5-chloro-4-(4-ethylsulfanylbutan-2-ylamino)-6-oxopyridazin-1-yl]acetate (PubChem CID 114443374) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-(4-ethylsulfanylbutan-2-ylamino)-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-(4-ethylsulfanylbutan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114443374 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | methyl 2-[5-chloro-4-(4-ethylsulfanylbutan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
| SMILES | CCSCCC(C)Nc1cnn(CC(=O)OC)c(=O)c1Cl |
| InChI | InChI=1S/C13H20ClN3O3S/c1-4-21-6-5-9(2)16-10-7-15-17(8-11(18)20-3)13(19)12(10)14/h7,9,16H,4-6,8H2,1-3H3 |
| InChIKey | SSGFNXTZFAJKHA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|