C12H18ClN3O4 — CID 114441350
methyl 2-[5-chloro-4-(4-hydroxypentan-2-ylamino)-6-oxopyridazin-1-yl]acetate (PubChem CID 114441350) has the molecular formula C12H18ClN3O4 and a molecular weight of 303.75 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-(4-hydroxypentan-2-ylamino)-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-(4-hydroxypentan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114441350 |
| Molecular Formula | C12H18ClN3O4 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 2-[5-chloro-4-(4-hydroxypentan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC(C)CC(C)O)c(Cl)c1=O |
| InChI | InChI=1S/C12H18ClN3O4/c1-7(4-8(2)17)15-9-5-14-16(6-10(18)20-3)12(19)11(9)13/h5,7-8,15,17H,4,6H2,1-3H3 |
| InChIKey | USGGZPQAYZXTMW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |