C12H18ClN3O3S — CID 114442957
methyl 2-[5-chloro-4-(1-ethylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate (PubChem CID 114442957) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-(1-ethylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-(1-ethylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114442957 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | methyl 2-[5-chloro-4-(1-ethylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
| SMILES | CCSCC(C)Nc1cnn(CC(=O)OC)c(=O)c1Cl |
| InChI | InChI=1S/C12H18ClN3O3S/c1-4-20-7-8(2)15-9-5-14-16(6-10(17)19-3)12(18)11(9)13/h5,8,15H,4,6-7H2,1-3H3 |
| InChIKey | JBZMPLRFOHMTMN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |