C11H18ClN3OS — CID 114442160
4-chloro-5-(1-methylsulfanylpropan-2-ylamino)-2-propylpyridazin-3-one (PubChem CID 114442160) has the molecular formula C11H18ClN3OS and a molecular weight of 275.81 g/mol. Its IUPAC name is 4-chloro-5-(1-methylsulfanylpropan-2-ylamino)-2-propylpyridazin-3-one.
| Compound Name | 4-chloro-5-(1-methylsulfanylpropan-2-ylamino)-2-propylpyridazin-3-one |
|---|---|
| PubChem CID | 114442160 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-chloro-5-(1-methylsulfanylpropan-2-ylamino)-2-propylpyridazin-3-one |
| SMILES | CCCn1ncc(NC(C)CSC)c(Cl)c1=O |
| InChI | InChI=1S/C11H18ClN3OS/c1-4-5-15-11(16)10(12)9(6-13-15)14-8(2)7-17-3/h6,8,14H,4-5,7H2,1-3H3 |
| InChIKey | SJSVHYKMNUQZLF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |