C11H16ClN3O3S — CID 114442161
methyl 2-[5-chloro-4-(1-methylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate (PubChem CID 114442161) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-(1-methylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-(1-methylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114442161 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | methyl 2-[5-chloro-4-(1-methylsulfanylpropan-2-ylamino)-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC(C)CSC)c(Cl)c1=O |
| InChI | InChI=1S/C11H16ClN3O3S/c1-7(6-19-3)14-8-4-13-15(5-9(16)18-2)11(17)10(8)12/h4,7,14H,5-6H2,1-3H3 |
| InChIKey | RRDGSTUIJMQUHL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |