C10H16ClN3O2S — CID 114442164
4-chloro-2-(2-hydroxyethyl)-5-(1-methylsulfanylpropan-2-ylamino)pyridazin-3-one (PubChem CID 114442164) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyethyl)-5-(1-methylsulfanylpropan-2-ylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-hydroxyethyl)-5-(1-methylsulfanylpropan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114442164 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-chloro-2-(2-hydroxyethyl)-5-(1-methylsulfanylpropan-2-ylamino)pyridazin-3-one |
| SMILES | CSCC(C)Nc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C10H16ClN3O2S/c1-7(6-17-2)13-8-5-12-14(3-4-15)10(16)9(8)11/h5,7,13,15H,3-4,6H2,1-2H3 |
| InChIKey | QUULHTNUWGQZPR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |