C11H18ClN3O3 — CID 114442513
4-chloro-2-(2-hydroxyethyl)-5-[(4-hydroxy-3-methylbutan-2-yl)amino]pyridazin-3-one (PubChem CID 114442513) has the molecular formula C11H18ClN3O3 and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyethyl)-5-[(4-hydroxy-3-methylbutan-2-yl)amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-hydroxyethyl)-5-[(4-hydroxy-3-methylbutan-2-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114442513 |
| Molecular Formula | C11H18ClN3O3 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-chloro-2-(2-hydroxyethyl)-5-[(4-hydroxy-3-methylbutan-2-yl)amino]pyridazin-3-one |
| SMILES | CC(CO)C(C)Nc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C11H18ClN3O3/c1-7(6-17)8(2)14-9-5-13-15(3-4-16)11(18)10(9)12/h5,7-8,14,16-17H,3-4,6H2,1-2H3 |
| InChIKey | HSXNJRVCENXSTQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |