C14H15BrClN3O2 — CID 114435836
5-[1-(4-bromophenyl)ethylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114435836) has the molecular formula C14H15BrClN3O2 and a molecular weight of 372.65 g/mol. Its IUPAC name is 5-[1-(4-bromophenyl)ethylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 5-[1-(4-bromophenyl)ethylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114435836 |
| Molecular Formula | C14H15BrClN3O2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 5-[1-(4-bromophenyl)ethylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | CC(Nc1cnn(CCO)c(=O)c1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrClN3O2/c1-9(10-2-4-11(15)5-3-10)18-12-8-17-19(6-7-20)14(21)13(12)16/h2-5,8-9,18,20H,6-7H2,1H3 |
| InChIKey | VQMHBENOOXEUOC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |