C13H21ClN4O3 — CID 114445256
methyl 2-[4-[(1-amino-4-methylpentan-2-yl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate (PubChem CID 114445256) has the molecular formula C13H21ClN4O3 and a molecular weight of 316.79 g/mol. Its IUPAC name is methyl 2-[4-[(1-amino-4-methylpentan-2-yl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(1-amino-4-methylpentan-2-yl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114445256 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl 2-[4-[(1-amino-4-methylpentan-2-yl)amino]-5-chloro-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NC(CN)CC(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C13H21ClN4O3/c1-8(2)4-9(5-15)17-10-6-16-18(7-11(19)21-3)13(20)12(10)14/h6,8-9,17H,4-5,7,15H2,1-3H3 |
| InChIKey | IKWXWKZFEKGDQD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |