C12H21ClN4O2 — CID 114442752
4-chloro-2-[2-(dimethylamino)ethyl]-5-(2-hydroxybutylamino)pyridazin-3-one (PubChem CID 114442752) has the molecular formula C12H21ClN4O2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl]-5-(2-hydroxybutylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(2-hydroxybutylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114442752 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(2-hydroxybutylamino)pyridazin-3-one |
| SMILES | CCC(O)CNc1cnn(CCN(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C12H21ClN4O2/c1-4-9(18)7-14-10-8-15-17(6-5-16(2)3)12(19)11(10)13/h8-9,14,18H,4-7H2,1-3H3 |
| InChIKey | OAJVMHNGIOIXAJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |