C12H19ClN4O3 — CID 114437296
methyl 2-[5-chloro-4-[2-[ethyl(methyl)amino]ethylamino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114437296) has the molecular formula C12H19ClN4O3 and a molecular weight of 302.76 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[2-[ethyl(methyl)amino]ethylamino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-[2-[ethyl(methyl)amino]ethylamino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114437296 |
| Molecular Formula | C12H19ClN4O3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | methyl 2-[5-chloro-4-[2-[ethyl(methyl)amino]ethylamino]-6-oxopyridazin-1-yl]acetate |
| SMILES | CCN(C)CCNc1cnn(CC(=O)OC)c(=O)c1Cl |
| InChI | InChI=1S/C12H19ClN4O3/c1-4-16(2)6-5-14-9-7-15-17(8-10(18)20-3)12(19)11(9)13/h7,14H,4-6,8H2,1-3H3 |
| InChIKey | JQGFKLVZHYDEQP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |