C13H21BrN4O3 — CID 114431857
methyl 2-[5-bromo-4-[2-(diethylamino)ethylamino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114431857) has the molecular formula C13H21BrN4O3 and a molecular weight of 361.24 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[2-(diethylamino)ethylamino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-4-[2-(diethylamino)ethylamino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114431857 |
| Molecular Formula | C13H21BrN4O3 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | methyl 2-[5-bromo-4-[2-(diethylamino)ethylamino]-6-oxopyridazin-1-yl]acetate |
| SMILES | CCN(CC)CCNc1cnn(CC(=O)OC)c(=O)c1Br |
| InChI | InChI=1S/C13H21BrN4O3/c1-4-17(5-2)7-6-15-10-8-16-18(9-11(19)21-3)13(20)12(10)14/h8,15H,4-7,9H2,1-3H3 |
| InChIKey | HZBZLGFCPVYLLA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |