C11H16BrN3O5 — CID 114437099
methyl 2-[5-bromo-4-[2-(2-hydroxyethoxy)ethylamino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114437099) has the molecular formula C11H16BrN3O5 and a molecular weight of 350.17 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[2-(2-hydroxyethoxy)ethylamino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-4-[2-(2-hydroxyethoxy)ethylamino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114437099 |
| Molecular Formula | C11H16BrN3O5 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | methyl 2-[5-bromo-4-[2-(2-hydroxyethoxy)ethylamino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NCCOCCO)c(Br)c1=O |
| InChI | InChI=1S/C11H16BrN3O5/c1-19-9(17)7-15-11(18)10(12)8(6-14-15)13-2-4-20-5-3-16/h6,13,16H,2-5,7H2,1H3 |
| InChIKey | FICLEHUIWKQUPP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|