C12H18ClN3O5 — CID 106311103
methyl 2-[5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-6-oxopyridazin-1-yl]acetate (PubChem CID 106311103) has the molecular formula C12H18ClN3O5 and a molecular weight of 319.75 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 106311103 |
| Molecular Formula | C12H18ClN3O5 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | methyl 2-[5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NCCCOCCO)c(Cl)c1=O |
| InChI | InChI=1S/C12H18ClN3O5/c1-20-10(18)8-16-12(19)11(13)9(7-15-16)14-3-2-5-21-6-4-17/h7,14,17H,2-6,8H2,1H3 |
| InChIKey | YYEOPXQCQWYLHQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|