C12H11Br2N3O3S — CID 114434336
methyl 2-[5-bromo-4-[(5-bromothiophen-2-yl)methylamino]-6-oxopyridazin-1-yl]acetate (PubChem CID 114434336) has the molecular formula C12H11Br2N3O3S and a molecular weight of 437.11 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(5-bromothiophen-2-yl)methylamino]-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(5-bromothiophen-2-yl)methylamino]-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114434336 |
| Molecular Formula | C12H11Br2N3O3S |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | methyl 2-[5-bromo-4-[(5-bromothiophen-2-yl)methylamino]-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NCc2ccc(Br)s2)c(Br)c1=O |
| InChI | InChI=1S/C12H11Br2N3O3S/c1-20-10(18)6-17-12(19)11(14)8(5-16-17)15-4-7-2-3-9(13)21-7/h2-3,5,15H,4,6H2,1H3 |
| InChIKey | RUYWJAGTQBGXHV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |