C11H11Br2N3O2S — CID 114434340
4-bromo-5-[(5-bromothiophen-2-yl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114434340) has the molecular formula C11H11Br2N3O2S and a molecular weight of 409.10 g/mol. Its IUPAC name is 4-bromo-5-[(5-bromothiophen-2-yl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-[(5-bromothiophen-2-yl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114434340 |
| Molecular Formula | C11H11Br2N3O2S |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 406.89 |
| IUPAC Name | 4-bromo-5-[(5-bromothiophen-2-yl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCc2ccc(Br)s2)cnn1CCO |
| InChI | InChI=1S/C11H11Br2N3O2S/c12-9-2-1-7(19-9)5-14-8-6-15-16(3-4-17)11(18)10(8)13/h1-2,6,14,17H,3-5H2 |
| InChIKey | FQZAWWGAFJDSFC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |