C12H14BrN3OS — CID 114436760
4-bromo-2-ethyl-5-[(5-methylthiophen-2-yl)methylamino]pyridazin-3-one (PubChem CID 114436760) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is 4-bromo-2-ethyl-5-[(5-methylthiophen-2-yl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-ethyl-5-[(5-methylthiophen-2-yl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114436760 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 4-bromo-2-ethyl-5-[(5-methylthiophen-2-yl)methylamino]pyridazin-3-one |
| SMILES | CCn1ncc(NCc2ccc(C)s2)c(Br)c1=O |
| InChI | InChI=1S/C12H14BrN3OS/c1-3-16-12(17)11(13)10(7-15-16)14-6-9-5-4-8(2)18-9/h4-5,7,14H,3,6H2,1-2H3 |
| InChIKey | IOBLLVACKSOKNL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |