C10H9BrClN3OS — CID 113235057
4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-methylpyridazin-3-one (PubChem CID 113235057) has the molecular formula C10H9BrClN3OS and a molecular weight of 334.63 g/mol. Its IUPAC name is 4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 113235057 |
| Molecular Formula | C10H9BrClN3OS |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | 4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCc2ccc(Cl)s2)c(Br)c1=O |
| InChI | InChI=1S/C10H9BrClN3OS/c1-15-10(16)9(11)7(5-14-15)13-4-6-2-3-8(12)17-6/h2-3,5,13H,4H2,1H3 |
| InChIKey | GSDDROZZAOULCN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |