C11H12BrN3OS — CID 114440266
4-bromo-2-methyl-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one (PubChem CID 114440266) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114440266 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 4-bromo-2-methyl-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one |
| SMILES | Cc1cscc1CNc1cnn(C)c(=O)c1Br |
| InChI | InChI=1S/C11H12BrN3OS/c1-7-5-17-6-8(7)3-13-9-4-14-15(2)11(16)10(9)12/h4-6,13H,3H2,1-2H3 |
| InChIKey | HDPXVFRALYYKKF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |