C13H16BrN3O2S — CID 114440270
4-bromo-2-(2-methoxyethyl)-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one (PubChem CID 114440270) has the molecular formula C13H16BrN3O2S and a molecular weight of 358.26 g/mol. Its IUPAC name is 4-bromo-2-(2-methoxyethyl)-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-methoxyethyl)-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114440270 |
| Molecular Formula | C13H16BrN3O2S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 4-bromo-2-(2-methoxyethyl)-5-[(4-methylthiophen-3-yl)methylamino]pyridazin-3-one |
| SMILES | COCCn1ncc(NCc2cscc2C)c(Br)c1=O |
| InChI | InChI=1S/C13H16BrN3O2S/c1-9-7-20-8-10(9)5-15-11-6-16-17(3-4-19-2)13(18)12(11)14/h6-8,15H,3-5H2,1-2H3 |
| InChIKey | LWKUDUNHXSYZON-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |