C11H18BrN3O3S — CID 114442483
4-bromo-2-(2-methoxyethyl)-5-(2-methylsulfinylpropylamino)pyridazin-3-one (PubChem CID 114442483) has the molecular formula C11H18BrN3O3S and a molecular weight of 352.25 g/mol. Its IUPAC name is 4-bromo-2-(2-methoxyethyl)-5-(2-methylsulfinylpropylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-methoxyethyl)-5-(2-methylsulfinylpropylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114442483 |
| Molecular Formula | C11H18BrN3O3S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 4-bromo-2-(2-methoxyethyl)-5-(2-methylsulfinylpropylamino)pyridazin-3-one |
| SMILES | COCCn1ncc(NCC(C)S(C)=O)c(Br)c1=O |
| InChI | InChI=1S/C11H18BrN3O3S/c1-8(19(3)17)6-13-9-7-14-15(4-5-18-2)11(16)10(9)12/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | BMONKVVYMOKZKI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |