C10H14BrN3O4 — CID 114432347
methyl 2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]acetate (PubChem CID 114432347) has the molecular formula C10H14BrN3O4 and a molecular weight of 320.14 g/mol. Its IUPAC name is methyl 2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]acetate.
| Compound Name | methyl 2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 114432347 |
| Molecular Formula | C10H14BrN3O4 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | methyl 2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]acetate |
| SMILES | COCCn1ncc(NCC(=O)OC)c(Br)c1=O |
| InChI | InChI=1S/C10H14BrN3O4/c1-17-4-3-14-10(16)9(11)7(5-13-14)12-6-8(15)18-2/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | CTHKXGHJYNXJNI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |