C11H17BrN4O3 — CID 114432337
methyl 2-[[5-bromo-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]acetate (PubChem CID 114432337) has the molecular formula C11H17BrN4O3 and a molecular weight of 333.19 g/mol. Its IUPAC name is methyl 2-[[5-bromo-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]acetate.
| Compound Name | methyl 2-[[5-bromo-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 114432337 |
| Molecular Formula | C11H17BrN4O3 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | methyl 2-[[5-bromo-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]acetate |
| SMILES | COC(=O)CNc1cnn(CCN(C)C)c(=O)c1Br |
| InChI | InChI=1S/C11H17BrN4O3/c1-15(2)4-5-16-11(18)10(12)8(6-14-16)13-7-9(17)19-3/h6,13H,4-5,7H2,1-3H3 |
| InChIKey | XNRPNDUONFQRSF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |