C13H23BrN4O — CID 114431621
4-bromo-2-[2-(dimethylamino)ethyl]-5-(pentan-3-ylamino)pyridazin-3-one (PubChem CID 114431621) has the molecular formula C13H23BrN4O and a molecular weight of 331.26 g/mol. Its IUPAC name is 4-bromo-2-[2-(dimethylamino)ethyl]-5-(pentan-3-ylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-[2-(dimethylamino)ethyl]-5-(pentan-3-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114431621 |
| Molecular Formula | C13H23BrN4O |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-bromo-2-[2-(dimethylamino)ethyl]-5-(pentan-3-ylamino)pyridazin-3-one |
| SMILES | CCC(CC)Nc1cnn(CCN(C)C)c(=O)c1Br |
| InChI | InChI=1S/C13H23BrN4O/c1-5-10(6-2)16-11-9-15-18(8-7-17(3)4)13(19)12(11)14/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | FRRLNQUACKDMNK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |