C14H26BrN5O — CID 114445301
5-[3-(aminomethyl)pentan-3-ylamino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one (PubChem CID 114445301) has the molecular formula C14H26BrN5O and a molecular weight of 360.30 g/mol. Its IUPAC name is 5-[3-(aminomethyl)pentan-3-ylamino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-[3-(aminomethyl)pentan-3-ylamino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114445301 |
| Molecular Formula | C14H26BrN5O |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 5-[3-(aminomethyl)pentan-3-ylamino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
| SMILES | CCC(CC)(CN)Nc1cnn(CCN(C)C)c(=O)c1Br |
| InChI | InChI=1S/C14H26BrN5O/c1-5-14(6-2,10-16)18-11-9-17-20(8-7-19(3)4)13(21)12(11)15/h9,18H,5-8,10,16H2,1-4H3 |
| InChIKey | NQJHIWGHYGIJLF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |