C14H24BrN5O — CID 114444160
5-[(2-aminocyclohexyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one (PubChem CID 114444160) has the molecular formula C14H24BrN5O and a molecular weight of 358.28 g/mol. Its IUPAC name is 5-[(2-aminocyclohexyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-[(2-aminocyclohexyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114444160 |
| Molecular Formula | C14H24BrN5O |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5-[(2-aminocyclohexyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
| SMILES | CN(C)CCn1ncc(NC2CCCCC2N)c(Br)c1=O |
| InChI | InChI=1S/C14H24BrN5O/c1-19(2)7-8-20-14(21)13(15)12(9-17-20)18-11-6-4-3-5-10(11)16/h9-11,18H,3-8,16H2,1-2H3 |
| InChIKey | AIRDGAORYAISNK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |