C14H18BrN5O — CID 114444754
5-(4-aminoanilino)-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one (PubChem CID 114444754) has the molecular formula C14H18BrN5O and a molecular weight of 352.24 g/mol. Its IUPAC name is 5-(4-aminoanilino)-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-(4-aminoanilino)-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114444754 |
| Molecular Formula | C14H18BrN5O |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 5-(4-aminoanilino)-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
| SMILES | CN(C)CCn1ncc(Nc2ccc(N)cc2)c(Br)c1=O |
| InChI | InChI=1S/C14H18BrN5O/c1-19(2)7-8-20-14(21)13(15)12(9-17-20)18-11-5-3-10(16)4-6-11/h3-6,9,18H,7-8,16H2,1-2H3 |
| InChIKey | QZGDAVIPLJKQQB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|