C14H23BrN4O4 — CID 104933125
tert-butyl N-[2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate (PubChem CID 104933125) has the molecular formula C14H23BrN4O4 and a molecular weight of 391.27 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 104933125 |
| Molecular Formula | C14H23BrN4O4 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | tert-butyl N-[2-[[5-bromo-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate |
| SMILES | COCCn1ncc(NCCNC(=O)OC(C)(C)C)c(Br)c1=O |
| InChI | InChI=1S/C14H23BrN4O4/c1-14(2,3)23-13(21)17-6-5-16-10-9-18-19(7-8-22-4)12(20)11(10)15/h9,16H,5-8H2,1-4H3,(H,17,21) |
| InChIKey | JPXSRUKVWHGNJP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|