C13H21BrN4O4 — CID 104933135
tert-butyl N-[2-[[5-bromo-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate (PubChem CID 104933135) has the molecular formula C13H21BrN4O4 and a molecular weight of 377.24 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-bromo-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-bromo-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 104933135 |
| Molecular Formula | C13H21BrN4O4 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | tert-butyl N-[2-[[5-bromo-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cnn(CCO)c(=O)c1Br |
| InChI | InChI=1S/C13H21BrN4O4/c1-13(2,3)22-12(21)16-5-4-15-9-8-17-18(6-7-19)11(20)10(9)14/h8,15,19H,4-7H2,1-3H3,(H,16,21) |
| InChIKey | IKDOJPYIRAGTBW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|