C12H19BrN4O2S — CID 106325980
4-bromo-2-(2-hydroxyethyl)-5-(2-thiomorpholin-4-ylethylamino)pyridazin-3-one (PubChem CID 106325980) has the molecular formula C12H19BrN4O2S and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-bromo-2-(2-hydroxyethyl)-5-(2-thiomorpholin-4-ylethylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-hydroxyethyl)-5-(2-thiomorpholin-4-ylethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 106325980 |
| Molecular Formula | C12H19BrN4O2S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-bromo-2-(2-hydroxyethyl)-5-(2-thiomorpholin-4-ylethylamino)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCCN2CCSCC2)cnn1CCO |
| InChI | InChI=1S/C12H19BrN4O2S/c13-11-10(9-15-17(3-6-18)12(11)19)14-1-2-16-4-7-20-8-5-16/h9,14,18H,1-8H2 |
| InChIKey | IUPFFJTYZAFDOY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |