C9H14BrN5O2 — CID 114441212
2-[(5-bromo-1-ethyl-6-oxopyridazin-4-yl)amino]ethylurea (PubChem CID 114441212) has the molecular formula C9H14BrN5O2 and a molecular weight of 304.15 g/mol. Its IUPAC name is 2-[(5-bromo-1-ethyl-6-oxopyridazin-4-yl)amino]ethylurea.
| Compound Name | 2-[(5-bromo-1-ethyl-6-oxopyridazin-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 114441212 |
| Molecular Formula | C9H14BrN5O2 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[(5-bromo-1-ethyl-6-oxopyridazin-4-yl)amino]ethylurea |
| SMILES | CCn1ncc(NCCNC(N)=O)c(Br)c1=O |
| InChI | InChI=1S/C9H14BrN5O2/c1-2-15-8(16)7(10)6(5-14-15)12-3-4-13-9(11)17/h5,12H,2-4H2,1H3,(H3,11,13,17) |
| InChIKey | LHTKDBCDLHJYNI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|