C12H21BrN4O — CID 114436162
4-bromo-5-[[2-(dimethylamino)-2-methylpropyl]amino]-2-ethylpyridazin-3-one (PubChem CID 114436162) has the molecular formula C12H21BrN4O and a molecular weight of 317.23 g/mol. Its IUPAC name is 4-bromo-5-[[2-(dimethylamino)-2-methylpropyl]amino]-2-ethylpyridazin-3-one.
| Compound Name | 4-bromo-5-[[2-(dimethylamino)-2-methylpropyl]amino]-2-ethylpyridazin-3-one |
|---|---|
| PubChem CID | 114436162 |
| Molecular Formula | C12H21BrN4O |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-bromo-5-[[2-(dimethylamino)-2-methylpropyl]amino]-2-ethylpyridazin-3-one |
| SMILES | CCn1ncc(NCC(C)(C)N(C)C)c(Br)c1=O |
| InChI | InChI=1S/C12H21BrN4O/c1-6-17-11(18)10(13)9(7-15-17)14-8-12(2,3)16(4)5/h7,14H,6,8H2,1-5H3 |
| InChIKey | ZLZLVEDGZPFNLO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |