C15H26BrN3O — CID 114440344
4-bromo-5-(2,2-dimethylheptylamino)-2-ethylpyridazin-3-one (PubChem CID 114440344) has the molecular formula C15H26BrN3O and a molecular weight of 344.30 g/mol. Its IUPAC name is 4-bromo-5-(2,2-dimethylheptylamino)-2-ethylpyridazin-3-one.
| Compound Name | 4-bromo-5-(2,2-dimethylheptylamino)-2-ethylpyridazin-3-one |
|---|---|
| PubChem CID | 114440344 |
| Molecular Formula | C15H26BrN3O |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-bromo-5-(2,2-dimethylheptylamino)-2-ethylpyridazin-3-one |
| SMILES | CCCCCC(C)(C)CNc1cnn(CC)c(=O)c1Br |
| InChI | InChI=1S/C15H26BrN3O/c1-5-7-8-9-15(3,4)11-17-12-10-18-19(6-2)14(20)13(12)16/h10,17H,5-9,11H2,1-4H3 |
| InChIKey | XLTFKJJUAGXDNX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|