C14H24BrN3O — CID 114443259
4-bromo-2-butyl-5-(3,3-dimethylbutylamino)pyridazin-3-one (PubChem CID 114443259) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is 4-bromo-2-butyl-5-(3,3-dimethylbutylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-butyl-5-(3,3-dimethylbutylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114443259 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 4-bromo-2-butyl-5-(3,3-dimethylbutylamino)pyridazin-3-one |
| SMILES | CCCCn1ncc(NCCC(C)(C)C)c(Br)c1=O |
| InChI | InChI=1S/C14H24BrN3O/c1-5-6-9-18-13(19)12(15)11(10-17-18)16-8-7-14(2,3)4/h10,16H,5-9H2,1-4H3 |
| InChIKey | DAFLWYNPMSJPMF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |