C13H22BrN5O2 — CID 114441187
3-[2-[(5-bromo-1-butyl-6-oxopyridazin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 114441187) has the molecular formula C13H22BrN5O2 and a molecular weight of 360.26 g/mol. Its IUPAC name is 3-[2-[(5-bromo-1-butyl-6-oxopyridazin-4-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(5-bromo-1-butyl-6-oxopyridazin-4-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 114441187 |
| Molecular Formula | C13H22BrN5O2 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-[2-[(5-bromo-1-butyl-6-oxopyridazin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CCCCn1ncc(NCCNC(=O)N(C)C)c(Br)c1=O |
| InChI | InChI=1S/C13H22BrN5O2/c1-4-5-8-19-12(20)11(14)10(9-17-19)15-6-7-16-13(21)18(2)3/h9,15H,4-8H2,1-3H3,(H,16,21) |
| InChIKey | XFUVDQYWYJXGQA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|