C14H25BrN4O2 — CID 106149044
4-bromo-2-butyl-5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]pyridazin-3-one (PubChem CID 106149044) has the molecular formula C14H25BrN4O2 and a molecular weight of 361.28 g/mol. Its IUPAC name is 4-bromo-2-butyl-5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-butyl-5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 106149044 |
| Molecular Formula | C14H25BrN4O2 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-bromo-2-butyl-5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]pyridazin-3-one |
| SMILES | CCCCn1ncc(NCC(C)(O)CN(C)C)c(Br)c1=O |
| InChI | InChI=1S/C14H25BrN4O2/c1-5-6-7-19-13(20)12(15)11(8-17-19)16-9-14(2,21)10-18(3)4/h8,16,21H,5-7,9-10H2,1-4H3 |
| InChIKey | NOIQDENOIURPNR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |