C13H22BrN3O2 — CID 114438893
4-bromo-2-butyl-5-[(1-hydroxy-2-methylbutan-2-yl)amino]pyridazin-3-one (PubChem CID 114438893) has the molecular formula C13H22BrN3O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 4-bromo-2-butyl-5-[(1-hydroxy-2-methylbutan-2-yl)amino]pyridazin-3-one.
| Compound Name | 4-bromo-2-butyl-5-[(1-hydroxy-2-methylbutan-2-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114438893 |
| Molecular Formula | C13H22BrN3O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-bromo-2-butyl-5-[(1-hydroxy-2-methylbutan-2-yl)amino]pyridazin-3-one |
| SMILES | CCCCn1ncc(NC(C)(CC)CO)c(Br)c1=O |
| InChI | InChI=1S/C13H22BrN3O2/c1-4-6-7-17-12(19)11(14)10(8-15-17)16-13(3,5-2)9-18/h8,16,18H,4-7,9H2,1-3H3 |
| InChIKey | VQSXYVXLYHMVTA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |