C12H13BrClN3OS — CID 114438575
4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-propan-2-ylpyridazin-3-one (PubChem CID 114438575) has the molecular formula C12H13BrClN3OS and a molecular weight of 362.68 g/mol. Its IUPAC name is 4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-propan-2-ylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114438575 |
| Molecular Formula | C12H13BrClN3OS |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 4-bromo-5-[(5-chlorothiophen-2-yl)methylamino]-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1ncc(NCc2ccc(Cl)s2)c(Br)c1=O |
| InChI | InChI=1S/C12H13BrClN3OS/c1-7(2)17-12(18)11(13)9(6-16-17)15-5-8-3-4-10(14)19-8/h3-4,6-7,15H,5H2,1-2H3 |
| InChIKey | IUKZTHMMWKYXOM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |