C12H17BrF3N3O — CID 114440849
4-bromo-2-propan-2-yl-5-(5,5,5-trifluoropentylamino)pyridazin-3-one (PubChem CID 114440849) has the molecular formula C12H17BrF3N3O and a molecular weight of 356.19 g/mol. Its IUPAC name is 4-bromo-2-propan-2-yl-5-(5,5,5-trifluoropentylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-propan-2-yl-5-(5,5,5-trifluoropentylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114440849 |
| Molecular Formula | C12H17BrF3N3O |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-bromo-2-propan-2-yl-5-(5,5,5-trifluoropentylamino)pyridazin-3-one |
| SMILES | CC(C)n1ncc(NCCCCC(F)(F)F)c(Br)c1=O |
| InChI | InChI=1S/C12H17BrF3N3O/c1-8(2)19-11(20)10(13)9(7-18-19)17-6-4-3-5-12(14,15)16/h7-8,17H,3-6H2,1-2H3 |
| InChIKey | WZUGIXPWRGESDV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|