C11H15BrF3N3O2 — CID 114438165
4-bromo-2-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one (PubChem CID 114438165) has the molecular formula C11H15BrF3N3O2 and a molecular weight of 358.16 g/mol. Its IUPAC name is 4-bromo-2-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114438165 |
| Molecular Formula | C11H15BrF3N3O2 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 4-bromo-2-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one |
| SMILES | CC(C)n1ncc(NCCOCC(F)(F)F)c(Br)c1=O |
| InChI | InChI=1S/C11H15BrF3N3O2/c1-7(2)18-10(19)9(12)8(5-17-18)16-3-4-20-6-11(13,14)15/h5,7,16H,3-4,6H2,1-2H3 |
| InChIKey | ZRCRREDYEZHKBP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|