C13H23BrN4O2 — CID 114437453
4-bromo-5-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-propan-2-ylpyridazin-3-one (PubChem CID 114437453) has the molecular formula C13H23BrN4O2 and a molecular weight of 347.26 g/mol. Its IUPAC name is 4-bromo-5-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-propan-2-ylpyridazin-3-one.
| Compound Name | 4-bromo-5-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114437453 |
| Molecular Formula | C13H23BrN4O2 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-bromo-5-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-propan-2-ylpyridazin-3-one |
| SMILES | COCCN(C)CCNc1cnn(C(C)C)c(=O)c1Br |
| InChI | InChI=1S/C13H23BrN4O2/c1-10(2)18-13(19)12(14)11(9-16-18)15-5-6-17(3)7-8-20-4/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | QCWWGTPBDROVQD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |