C11H18BrN3O3S — CID 114434481
4-bromo-5-(3-methylsulfonylpropylamino)-2-propan-2-ylpyridazin-3-one (PubChem CID 114434481) has the molecular formula C11H18BrN3O3S and a molecular weight of 352.25 g/mol. Its IUPAC name is 4-bromo-5-(3-methylsulfonylpropylamino)-2-propan-2-ylpyridazin-3-one.
| Compound Name | 4-bromo-5-(3-methylsulfonylpropylamino)-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114434481 |
| Molecular Formula | C11H18BrN3O3S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 4-bromo-5-(3-methylsulfonylpropylamino)-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1ncc(NCCCS(C)(=O)=O)c(Br)c1=O |
| InChI | InChI=1S/C11H18BrN3O3S/c1-8(2)15-11(16)10(12)9(7-14-15)13-5-4-6-19(3,17)18/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | NRJLJGSSWDJAOH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|