C10H13BrF3N3O2 — CID 114438163
4-bromo-2-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one (PubChem CID 114438163) has the molecular formula C10H13BrF3N3O2 and a molecular weight of 344.13 g/mol. Its IUPAC name is 4-bromo-2-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114438163 |
| Molecular Formula | C10H13BrF3N3O2 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 4-bromo-2-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one |
| SMILES | CCn1ncc(NCCOCC(F)(F)F)c(Br)c1=O |
| InChI | InChI=1S/C10H13BrF3N3O2/c1-2-17-9(18)8(11)7(5-16-17)15-3-4-19-6-10(12,13)14/h5,15H,2-4,6H2,1H3 |
| InChIKey | VXECXBAASIAFMY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|