C13H14BrN3O2 — CID 114432062
5-(benzylamino)-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114432062) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 5-(benzylamino)-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 5-(benzylamino)-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114432062 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 5-(benzylamino)-4-bromo-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCc2ccccc2)cnn1CCO |
| InChI | InChI=1S/C13H14BrN3O2/c14-12-11(9-16-17(6-7-18)13(12)19)15-8-10-4-2-1-3-5-10/h1-5,9,15,18H,6-8H2 |
| InChIKey | NKBBPCXBGUDUNQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |