C11H13ClN6O3 — CID 114446280
methyl 2-[4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-chloro-6-oxopyridazin-1-yl]acetate (PubChem CID 114446280) has the molecular formula C11H13ClN6O3 and a molecular weight of 312.72 g/mol. Its IUPAC name is methyl 2-[4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-chloro-6-oxopyridazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-chloro-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114446280 |
| Molecular Formula | C11H13ClN6O3 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl 2-[4-[(5-amino-1H-pyrazol-4-yl)methylamino]-5-chloro-6-oxopyridazin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc(NCc2cn[nH]c2N)c(Cl)c1=O |
| InChI | InChI=1S/C11H13ClN6O3/c1-21-8(19)5-18-11(20)9(12)7(4-16-18)14-2-6-3-15-17-10(6)13/h3-4,14H,2,5H2,1H3,(H3,13,15,17) |
| InChIKey | SCLXGSYBVLXNMY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |