C10H13ClN6O2 — CID 114446303
5-[(5-amino-1H-pyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114446303) has the molecular formula C10H13ClN6O2 and a molecular weight of 284.71 g/mol. Its IUPAC name is 5-[(5-amino-1H-pyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 5-[(5-amino-1H-pyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114446303 |
| Molecular Formula | C10H13ClN6O2 |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-[(5-amino-1H-pyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | Nc1[nH]ncc1CNc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C10H13ClN6O2/c11-8-7(5-15-17(1-2-18)10(8)19)13-3-6-4-14-16-9(6)12/h4-5,13,18H,1-3H2,(H3,12,14,16) |
| InChIKey | OKPUKQVLAWAQTG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |