C11H14ClN5O2 — CID 114439562
4-chloro-5-(1H-imidazol-5-ylmethylamino)-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 114439562) has the molecular formula C11H14ClN5O2 and a molecular weight of 283.72 g/mol. Its IUPAC name is 4-chloro-5-(1H-imidazol-5-ylmethylamino)-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-(1H-imidazol-5-ylmethylamino)-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114439562 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-chloro-5-(1H-imidazol-5-ylmethylamino)-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(NCc2cnc[nH]2)c(Cl)c1=O |
| InChI | InChI=1S/C11H14ClN5O2/c1-19-3-2-17-11(18)10(12)9(6-16-17)14-5-8-4-13-7-15-8/h4,6-7,14H,2-3,5H2,1H3,(H,13,15) |
| InChIKey | SZJXVGPIBBTCMR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |