C9H7ClF3N3O — CID 114436888
4-chloro-5-(prop-2-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114436888) has the molecular formula C9H7ClF3N3O and a molecular weight of 265.62 g/mol. Its IUPAC name is 4-chloro-5-(prop-2-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-(prop-2-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114436888 |
| Molecular Formula | C9H7ClF3N3O |
| Molecular Weight | 265.62 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-chloro-5-(prop-2-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | C#CCNc1cnn(CC(F)(F)F)c(=O)c1Cl |
| InChI | InChI=1S/C9H7ClF3N3O/c1-2-3-14-6-4-15-16(5-9(11,12)13)8(17)7(6)10/h1,4,14H,3,5H2 |
| InChIKey | FPRXJFOFZSRZAY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.62 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|