C10H13ClF3N3OS — CID 114438289
4-chloro-5-(3-methylsulfanylpropylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114438289) has the molecular formula C10H13ClF3N3OS and a molecular weight of 315.75 g/mol. Its IUPAC name is 4-chloro-5-(3-methylsulfanylpropylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-(3-methylsulfanylpropylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114438289 |
| Molecular Formula | C10H13ClF3N3OS |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-chloro-5-(3-methylsulfanylpropylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | CSCCCNc1cnn(CC(F)(F)F)c(=O)c1Cl |
| InChI | InChI=1S/C10H13ClF3N3OS/c1-19-4-2-3-15-7-5-16-17(6-10(12,13)14)9(18)8(7)11/h5,15H,2-4,6H2,1H3 |
| InChIKey | KHFHFJGBGGDYNA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|