C11H16ClF3N4O2 — CID 114447244
4-chloro-5-[2-(2-hydroxypropylamino)ethylamino]-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114447244) has the molecular formula C11H16ClF3N4O2 and a molecular weight of 328.72 g/mol. Its IUPAC name is 4-chloro-5-[2-(2-hydroxypropylamino)ethylamino]-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(2-hydroxypropylamino)ethylamino]-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114447244 |
| Molecular Formula | C11H16ClF3N4O2 |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-chloro-5-[2-(2-hydroxypropylamino)ethylamino]-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | CC(O)CNCCNc1cnn(CC(F)(F)F)c(=O)c1Cl |
| InChI | InChI=1S/C11H16ClF3N4O2/c1-7(20)4-16-2-3-17-8-5-18-19(6-11(13,14)15)10(21)9(8)12/h5,7,16-17,20H,2-4,6H2,1H3 |
| InChIKey | HXZMDABRQFOUDP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|